C22H17F2NO5S — CID 2598584
[2-(3,4-difluorophenyl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2598584) has the molecular formula C22H17F2NO5S and a molecular weight of 445.44 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2598584 |
| Molecular Formula | C22H17F2NO5S |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C22H17F2NO5S/c1-25(17-5-3-2-4-6-17)31(28,29)18-10-7-15(8-11-18)22(27)30-14-21(26)16-9-12-19(23)20(24)13-16/h2-13H,14H2,1H3 |
| InChIKey | QRLVRXRYYASCDR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |