C20H16ClNO5S2 — CID 2680115
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 2680115) has the molecular formula C20H16ClNO5S2 and a molecular weight of 449.94 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2680115 |
| Molecular Formula | C20H16ClNO5S2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C20H16ClNO5S2/c1-22(15-5-3-2-4-6-15)29(25,26)16-9-7-14(8-10-16)20(24)27-13-17(23)18-11-12-19(21)28-18/h2-12H,13H2,1H3 |
| InChIKey | KLBIWZIDOQAEBK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |