C17H18ClNO5S2 — CID 7768017
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 7768017) has the molecular formula C17H18ClNO5S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7768017 |
| Molecular Formula | C17H18ClNO5S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CC(C)N(C)S(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C17H18ClNO5S2/c1-11(2)19(3)26(22,23)13-6-4-5-12(9-13)17(21)24-10-14(20)15-7-8-16(18)25-15/h4-9,11H,10H2,1-3H3 |
| InChIKey | XLDXHLIWTYZPIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |