C14H20N2O5S — CID 7753650
[2-(methylamino)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 7753650) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7753650 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CNC(=O)COC(=O)c1cccc(S(=O)(=O)N(C)C(C)C)c1 |
| InChI | InChI=1S/C14H20N2O5S/c1-10(2)16(4)22(19,20)12-7-5-6-11(8-12)14(18)21-9-13(17)15-3/h5-8,10H,9H2,1-4H3,(H,15,17) |
| InChIKey | BXIQEXHFQKWUQT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |