C15H22N2O5S — CID 7960640
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 7960640) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7960640 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-5-11(2)16-14(18)10-22-15(19)12-7-6-8-13(9-12)23(20,21)17(3)4/h6-9,11H,5,10H2,1-4H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | NTVFRXLXDCYDJY-LLVKDONJSA-N |
| XLogP | 1.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |