C17H23N3O5S — CID 7960646
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 7960646) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7960646 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H23N3O5S/c1-12(2)17(3,11-18)19-15(21)10-25-16(22)13-7-6-8-14(9-13)26(23,24)20(4)5/h6-9,12H,10H2,1-5H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | SXARJXUXTMZDTE-QGZVFWFLSA-N |
| XLogP | 1.15 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |