C19H26N2O3 — CID 2650971
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-tert-butylbenzoate (PubChem CID 2650971) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-tert-butylbenzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2650971 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-tert-butylbenzoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-13(2)19(6,12-20)21-16(22)11-24-17(23)14-7-9-15(10-8-14)18(3,4)5/h7-10,13H,11H2,1-6H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | UVTCEPSSQWRBLW-IBGZPJMESA-N |
| XLogP | 3.20 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |