C18H24N2O5 — CID 2624843
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate (PubChem CID 2624843) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 2624843 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-methoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N[C@](C)(C#N)C(C)C)cc1OC |
| InChI | InChI=1S/C18H24N2O5/c1-6-24-14-8-7-13(9-15(14)23-5)17(22)25-10-16(21)20-18(4,11-19)12(2)3/h7-9,12H,6,10H2,1-5H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | VFKVLLXTKGFDEF-GOSISDBHSA-N |
| XLogP | 2.31 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |