C15H16ClN3O5 — CID 2650922
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 2650922) has the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 2650922 |
| Molecular Formula | C15H16ClN3O5 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16ClN3O5/c1-9(2)15(3,8-17)18-13(20)7-24-14(21)10-4-5-11(16)12(6-10)19(22)23/h4-6,9H,7H2,1-3H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | KSERGUFJYJKTFY-OAHLLOKOSA-N |
| XLogP | 2.46 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|