C13H17N3O5 — CID 7781473
[2-(tert-butylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 7781473) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7781473 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O5/c1-13(2,3)15-11(17)7-21-12(18)8-4-5-9(14)10(6-8)16(19)20/h4-6H,7,14H2,1-3H3,(H,15,17) |
| InChIKey | DQICGJHBRGGXLK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|