C18H26N2O5S — CID 7791969
[2-(tert-butylamino)-2-oxoethyl] 4-(3-methylbutylsulfanyl)-3-nitrobenzoate (PubChem CID 7791969) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-(3-methylbutylsulfanyl)-3-nitrobenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-(3-methylbutylsulfanyl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7791969 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-(3-methylbutylsulfanyl)-3-nitrobenzoate |
| SMILES | CC(C)CCSc1ccc(C(=O)OCC(=O)NC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N2O5S/c1-12(2)8-9-26-15-7-6-13(10-14(15)20(23)24)17(22)25-11-16(21)19-18(3,4)5/h6-7,10,12H,8-9,11H2,1-5H3,(H,19,21) |
| InChIKey | PNKMUYGPENHESP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|