C14H21N3O3S — CID 9179517
N',N'-dimethyl-4-(3-methylbutylsulfanyl)-3-nitrobenzohydrazide (PubChem CID 9179517) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N',N'-dimethyl-4-(3-methylbutylsulfanyl)-3-nitrobenzohydrazide.
| Compound Name | N',N'-dimethyl-4-(3-methylbutylsulfanyl)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9179517 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N',N'-dimethyl-4-(3-methylbutylsulfanyl)-3-nitrobenzohydrazide |
| SMILES | CC(C)CCSc1ccc(C(=O)NN(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3S/c1-10(2)7-8-21-13-6-5-11(9-12(13)17(19)20)14(18)15-16(3)4/h5-6,9-10H,7-8H2,1-4H3,(H,15,18) |
| InChIKey | UXOZXCUFSYNZCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|