C17H25N3O3S — CID 112759575
[4-(3-methylbutylsulfanyl)-3-nitrophenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 112759575) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is [4-(3-methylbutylsulfanyl)-3-nitrophenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-(3-methylbutylsulfanyl)-3-nitrophenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 112759575 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [4-(3-methylbutylsulfanyl)-3-nitrophenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CC(C)CCSc1ccc(C(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O3S/c1-13(2)6-11-24-16-5-4-14(12-15(16)20(22)23)17(21)19-9-7-18(3)8-10-19/h4-5,12-13H,6-11H2,1-3H3 |
| InChIKey | WPWNCMVDCNYTNG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|