C16H23N3O3S — CID 112765444
[4-(2-methylpropyl)piperazin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone (PubChem CID 112765444) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is [4-(2-methylpropyl)piperazin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone.
| Compound Name | [4-(2-methylpropyl)piperazin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 112765444 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [4-(2-methylpropyl)piperazin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone |
| SMILES | CSc1ccc(C(=O)N2CCN(CC(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O3S/c1-12(2)11-17-6-8-18(9-7-17)16(20)13-4-5-15(23-3)14(10-13)19(21)22/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | GVKNQJRGZFAYDU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|