C16H20N2O5S — CID 4808933
ethyl 1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-4-carboxylate (PubChem CID 4808933) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4808933 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 1-(4-methylsulfanyl-3-nitrobenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(SC)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-23-16(20)11-6-8-17(9-7-11)15(19)12-4-5-14(24-2)13(10-12)18(21)22/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | CSHLLNRNEDOXMB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|