C16H17F4NO3 — CID 91730821
ethyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 91730821) has the molecular formula C16H17F4NO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is ethyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91730821 |
| Molecular Formula | C16H17F4NO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethyl 1-[3-fluoro-4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H17F4NO3/c1-2-24-15(23)10-5-7-21(8-6-10)14(22)11-3-4-12(13(17)9-11)16(18,19)20/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | JKAFYXZATGZUSF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |