C19H27NO4 — CID 110762331
ethyl 1-(3-methyl-4-propan-2-yloxybenzoyl)piperidine-4-carboxylate (PubChem CID 110762331) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 1-(3-methyl-4-propan-2-yloxybenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-methyl-4-propan-2-yloxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 110762331 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethyl 1-(3-methyl-4-propan-2-yloxybenzoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(OC(C)C)c(C)c2)CC1 |
| InChI | InChI=1S/C19H27NO4/c1-5-23-19(22)15-8-10-20(11-9-15)18(21)16-6-7-17(14(4)12-16)24-13(2)3/h6-7,12-13,15H,5,8-11H2,1-4H3 |
| InChIKey | BSGRKHPAEGELMQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |