C20H19F4NO — CID 46086895
(4-benzylpiperidin-1-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanone (PubChem CID 46086895) has the molecular formula C20H19F4NO and a molecular weight of 365.37 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 46086895 |
| Molecular Formula | C20H19F4NO |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[3-fluoro-4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)c(F)c1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H19F4NO/c21-18-13-16(6-7-17(18)20(22,23)24)19(26)25-10-8-15(9-11-25)12-14-4-2-1-3-5-14/h1-7,13,15H,8-12H2 |
| InChIKey | KHRQEHGWQFEHMJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |