C13H14F4N2O — CID 173469715
3-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 173469715) has the molecular formula C13H14F4N2O and a molecular weight of 290.26 g/mol. Its IUPAC name is 3-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 173469715 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(Cc2ccc(C(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C13H14F4N2O/c14-11-6-8(1-2-10(11)13(15,16)17)5-9-3-4-19(7-9)12(18)20/h1-2,6,9H,3-5,7H2,(H2,18,20) |
| InChIKey | TVODYXZNCLQQGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |