C18H17F2NO3 — CID 122139592
[3-[(3,4-difluorophenyl)methyl]pyrrolidin-1-yl]-(2,3-dihydroxyphenyl)methanone (PubChem CID 122139592) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is [3-[(3,4-difluorophenyl)methyl]pyrrolidin-1-yl]-(2,3-dihydroxyphenyl)methanone.
| Compound Name | [3-[(3,4-difluorophenyl)methyl]pyrrolidin-1-yl]-(2,3-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 122139592 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [3-[(3,4-difluorophenyl)methyl]pyrrolidin-1-yl]-(2,3-dihydroxyphenyl)methanone |
| SMILES | O=C(c1cccc(O)c1O)N1CCC(Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H17F2NO3/c19-14-5-4-11(9-15(14)20)8-12-6-7-21(10-12)18(24)13-2-1-3-16(22)17(13)23/h1-5,9,12,22-23H,6-8,10H2 |
| InChIKey | WXSIBXKZVNPDKK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|