C16H19F2NO3 — CID 122065991
3-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-2-methyl-3-oxopropanoic acid (PubChem CID 122065991) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122065991 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCC(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H19F2NO3/c1-10(16(21)22)15(20)19-6-4-11(5-7-19)8-12-2-3-13(17)14(18)9-12/h2-3,9-11H,4-8H2,1H3,(H,21,22) |
| InChIKey | HTGPXCVIEBFAHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|