C13H15BrFNO2 — CID 67000077
4-[(4-bromo-3-fluorophenyl)methyl]piperidine-1-carboxylic acid (PubChem CID 67000077) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is 4-[(4-bromo-3-fluorophenyl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(4-bromo-3-fluorophenyl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67000077 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-[(4-bromo-3-fluorophenyl)methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Cc2ccc(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C13H15BrFNO2/c14-11-2-1-10(8-12(11)15)7-9-3-5-16(6-4-9)13(17)18/h1-2,8-9H,3-7H2,(H,17,18) |
| InChIKey | LHQWYCNHQPWFEW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |