C25H21F4NO — CID 46086891
[4-[(4-phenylphenyl)methyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 46086891) has the molecular formula C25H21F4NO and a molecular weight of 427.44 g/mol. Its IUPAC name is [4-[(4-phenylphenyl)methyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone.
| Compound Name | [4-[(4-phenylphenyl)methyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 46086891 |
| Molecular Formula | C25H21F4NO |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [4-[(4-phenylphenyl)methyl]piperidin-1-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)cc(F)c1F)N1CCC(Cc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H21F4NO/c26-20-15-21(27)24(29)22(23(20)28)25(31)30-12-10-17(11-13-30)14-16-6-8-19(9-7-16)18-4-2-1-3-5-18/h1-9,15,17H,10-14H2 |
| InChIKey | AYAKSSJGMYSHRD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|