C21H26N2O2 — CID 142479897
(2R)-2-amino-3-hydroxy-1-[4-[(4-phenylphenyl)methyl]piperidin-1-yl]propan-1-one (PubChem CID 142479897) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R)-2-amino-3-hydroxy-1-[4-[(4-phenylphenyl)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2-amino-3-hydroxy-1-[4-[(4-phenylphenyl)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 142479897 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2R)-2-amino-3-hydroxy-1-[4-[(4-phenylphenyl)methyl]piperidin-1-yl]propan-1-one |
| SMILES | N[C@H](CO)C(=O)N1CCC(Cc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O2/c22-20(15-24)21(25)23-12-10-17(11-13-23)14-16-6-8-19(9-7-16)18-4-2-1-3-5-18/h1-9,17,20,24H,10-15,22H2/t20-/m1/s1 |
| InChIKey | KNHOJKNZNDTYHM-HXUWFJFHSA-N |
| XLogP | 2.45 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |