About [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate (PubChem CID 23827029) has the molecular formula C27H27NO3
and a molecular weight of 413.52 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate |
| PubChem CID | 23827029 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate |
| SMILES | O=C(OCC(=O)N1CCC(Cc2ccccc2)CC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO3/c29-26(28-17-15-22(16-18-28)19-21-7-3-1-4-8-21)20-31-27(30)25-13-11-24(12-14-25)23-9-5-2-6-10-23/h1-14,22H,15-20H2 |
| InChIKey | OTHYAGRVAAHRRS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate?
The IUPAC name of [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate (CID 23827029) is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate.
What is the SMILES notation for [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate?
The canonical SMILES for [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate is O=C(OCC(=O)N1CCC(Cc2ccccc2)CC1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate?
The InChIKey is OTHYAGRVAAHRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27NO3/c29-26(28-17-15-22(16-18-28)19-21-7-3-1-4-8-21)20-31-27(30)25-13-11-24(12-14-25)23-9-5-2-6-10-23/h1-14,22H,15-20H2.
What are the key properties of [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate?
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate has a molecular weight of 413.52 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-phenylbenzoate is sourced from PubChem (CID 23827029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).