C27H27NO4 — CID 23909728
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-phenoxybenzoate (PubChem CID 23909728) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-phenoxybenzoate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-phenoxybenzoate |
|---|---|
| PubChem CID | 23909728 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-phenoxybenzoate |
| SMILES | O=C(OCC(=O)N1CCC(Cc2ccccc2)CC1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H27NO4/c29-26(28-16-14-22(15-17-28)18-21-8-3-1-4-9-21)20-31-27(30)23-10-7-13-25(19-23)32-24-11-5-2-6-12-24/h1-13,19,22H,14-18,20H2 |
| InChIKey | ZDCJLIVZYXGYJQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |