C20H20Cl2N2O3 — CID 2358006
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate (PubChem CID 2358006) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 2358006 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(OCC(=O)N1CCC(Cc2ccccc2)CC1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c21-17-11-16(12-18(22)23-17)20(26)27-13-19(25)24-8-6-15(7-9-24)10-14-4-2-1-3-5-14/h1-5,11-12,15H,6-10,13H2 |
| InChIKey | FXDJSSNOVRDWSZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|