C22H26N2O3 — CID 2340416
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 2340416) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 2340416 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCC(Cc3ccccc3)CC2)cc1N |
| InChI | InChI=1S/C22H26N2O3/c1-16-7-8-19(14-20(16)23)22(26)27-15-21(25)24-11-9-18(10-12-24)13-17-5-3-2-4-6-17/h2-8,14,18H,9-13,15,23H2,1H3 |
| InChIKey | SDSZSLMJOTXEIV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|