C25H30N2O5S — CID 4215362
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 4215362) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4215362 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCC(=O)N1CCC(Cc2ccccc2)CC1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H30N2O5S/c28-24(26-16-12-21(13-17-26)18-20-6-2-1-3-7-20)19-32-25(29)22-8-10-23(11-9-22)33(30,31)27-14-4-5-15-27/h1-3,6-11,21H,4-5,12-19H2 |
| InChIKey | QQFANTQPPUTTJK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |