C23H27NO3 — CID 2338180
[2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3,5-dimethylbenzoate (PubChem CID 2338180) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 2338180 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-(4-benzylpiperidin-1-yl)-2-oxoethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H27NO3/c1-17-12-18(2)14-21(13-17)23(26)27-16-22(25)24-10-8-20(9-11-24)15-19-6-4-3-5-7-19/h3-7,12-14,20H,8-11,15-16H2,1-2H3 |
| InChIKey | ULKZYENHRFJYHH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |