C19H21N3O7S2 — CID 55312799
[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate (PubChem CID 55312799) has the molecular formula C19H21N3O7S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate.
| Compound Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55312799 |
| Molecular Formula | C19H21N3O7S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)OCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O7S2/c20-30(25,26)16-8-6-15(7-9-16)19(24)29-14-18(23)21-10-12-22(13-11-21)31(27,28)17-4-2-1-3-5-17/h1-9H,10-14H2,(H2,20,25,26) |
| InChIKey | HZZNPEWTPYSCQF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |