C18H20N2O5S2 — CID 2640481
[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 2640481) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2640481 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-14-7-12-26-17(14)18(22)25-13-16(21)19-8-10-20(11-9-19)27(23,24)15-5-3-2-4-6-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | KOSNQWWCAHEURU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |