C19H21N3O6S — CID 7774349
[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 7774349) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is [2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7774349 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)c3cccc[n+]3[O-])CC2)cc1 |
| InChI | InChI=1S/C19H21N3O6S/c1-15-5-7-16(8-6-15)29(26,27)21-12-10-20(11-13-21)18(23)14-28-19(24)17-4-2-3-9-22(17)25/h2-9H,10-14H2,1H3 |
| InChIKey | NLUMLWIIQJSXEL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|