C19H21N3O5S — CID 7931291
4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethoxy]benzamide (PubChem CID 7931291) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 7931291 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O5S/c20-19(24)15-6-8-16(9-7-15)27-14-18(23)21-10-12-22(13-11-21)28(25,26)17-4-2-1-3-5-17/h1-9H,10-14H2,(H2,20,24) |
| InChIKey | TXIXSBRHJPHSRN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |