C20H21ClN2O5S — CID 18287130
1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 18287130) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 18287130 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)COc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21ClN2O5S/c1-15(24)16-2-8-19(9-3-16)29(26,27)23-12-10-22(11-13-23)20(25)14-28-18-6-4-17(21)5-7-18/h2-9H,10-14H2,1H3 |
| InChIKey | XPSJOVKDAIJIHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |