C29H27ClN2O5S — CID 175377895
1-[4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]-5-phenylpenta-1,4-dien-3-one (PubChem CID 175377895) has the molecular formula C29H27ClN2O5S and a molecular weight of 551.06 g/mol. Its IUPAC name is 1-[4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]-5-phenylpenta-1,4-dien-3-one.
| Compound Name | 1-[4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 175377895 |
| Molecular Formula | C29H27ClN2O5S |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 1-[4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]phenyl]-5-phenylpenta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccccc1)C=Cc1ccc(OCC(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H27ClN2O5S/c30-25-10-16-28(17-11-25)38(35,36)32-20-18-31(19-21-32)29(34)22-37-27-14-8-24(9-15-27)7-13-26(33)12-6-23-4-2-1-3-5-23/h1-17H,18-22H2 |
| InChIKey | FVGHMBVGPKOFAS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|