C21H20Cl2N2O5S — CID 42965375
[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 42965375) has the molecular formula C21H20Cl2N2O5S and a molecular weight of 483.37 g/mol. Its IUPAC name is [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42965375 |
| Molecular Formula | C21H20Cl2N2O5S |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)OCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H20Cl2N2O5S/c22-17-5-7-19(8-6-17)31(28,29)25-12-10-24(11-13-25)20(26)15-30-21(27)9-4-16-2-1-3-18(23)14-16/h1-9,14H,10-13,15H2/b9-4+ |
| InChIKey | DINMEKFKHNXORB-RUDMXATFSA-N |
| XLogP | 3.08 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|