C23H25N3O7S — CID 71953849
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 71953849) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71953849 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)C=Cc3cccc([N+](=O)[O-])c3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H25N3O7S/c1-17-6-8-21(18(2)14-17)34(31,32)25-12-10-24(11-13-25)22(27)16-33-23(28)9-7-19-4-3-5-20(15-19)26(29)30/h3-9,14-15H,10-13,16H2,1-2H3 |
| InChIKey | ZSCQNGIUZOPOHC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|