C21H23BrN2O6S — CID 3947658
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 3947658) has the molecular formula C21H23BrN2O6S and a molecular weight of 511.39 g/mol. Its IUPAC name is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3947658 |
| Molecular Formula | C21H23BrN2O6S |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)C=Cc3ccc(Br)o3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H23BrN2O6S/c1-15-3-6-18(16(2)13-15)31(27,28)24-11-9-23(10-12-24)20(25)14-29-21(26)8-5-17-4-7-19(22)30-17/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | JZPJKRKRJYPYRU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|