C25H30N2O7S — CID 71954136
[2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 71954136) has the molecular formula C25H30N2O7S and a molecular weight of 502.59 g/mol. Its IUPAC name is [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71954136 |
| Molecular Formula | C25H30N2O7S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [2-[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OCC(=O)N2CCN(S(=O)(=O)c3ccc(C)cc3C)CC2)cc1OC |
| InChI | InChI=1S/C25H30N2O7S/c1-18-5-9-23(19(2)15-18)35(30,31)27-13-11-26(12-14-27)24(28)17-34-25(29)10-7-20-6-8-21(32-3)22(16-20)33-4/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | SDWYYWMFQMIJCF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|