C19H24N2O7 — CID 8663471
ethyl 4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate (PubChem CID 8663471) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is ethyl 4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 8663471 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)/C=C/c2ccc(O)c(OC)c2)CC1 |
| InChI | InChI=1S/C19H24N2O7/c1-3-27-19(25)21-10-8-20(9-11-21)17(23)13-28-18(24)7-5-14-4-6-15(22)16(12-14)26-2/h4-7,12,22H,3,8-11,13H2,1-2H3/b7-5+ |
| InChIKey | MUHVTSARIMJDDU-FNORWQNLSA-N |
| XLogP | 1.26 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|