C23H23NO5 — CID 9200354
[2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 9200354) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9200354 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-oxo-2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)N2CC=C(c3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C23H23NO5/c1-28-21-15-17(7-9-20(21)25)8-10-23(27)29-16-22(26)24-13-11-19(12-14-24)18-5-3-2-4-6-18/h2-11,15,25H,12-14,16H2,1H3/b10-8+ |
| InChIKey | SKCVQNCMLRLWFU-CSKARUKUSA-N |
| XLogP | 3.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|