C13H16O5 — CID 86717646
2-methoxyethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 86717646) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-methoxyethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-methoxyethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 86717646 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-methoxyethyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COCCOC(=O)C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C13H16O5/c1-16-7-8-18-13(15)6-4-10-3-5-11(14)12(9-10)17-2/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | FXBWLAUQQQHKPD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|