C15H20O6 — CID 162830856
[(2S)-2,3-dimethoxypropyl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 162830856) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(2S)-2,3-dimethoxypropyl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-2,3-dimethoxypropyl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162830856 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(2S)-2,3-dimethoxypropyl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COC[C@@H](COC(=O)C=Cc1ccc(O)c(OC)c1)OC |
| InChI | InChI=1S/C15H20O6/c1-18-9-12(19-2)10-21-15(17)7-5-11-4-6-13(16)14(8-11)20-3/h4-8,12,16H,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VRTOHHVZFDFURI-LBPRGKRZSA-N |
| XLogP | 1.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|