C12H14O5 — CID 138530546
2-methoxyethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 138530546) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-methoxyethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 2-methoxyethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 138530546 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-methoxyethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | COCCOC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H14O5/c1-16-6-7-17-12(15)5-3-9-2-4-10(13)11(14)8-9/h2-5,8,13-14H,6-7H2,1H3/b5-3+ |
| InChIKey | KOLGJWVWYHLLAB-HWKANZROSA-N |
| XLogP | 1.30 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|