C17H16O4Se — CID 11595696
2-phenylselanylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 11595696) has the molecular formula C17H16O4Se and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-phenylselanylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 2-phenylselanylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11595696 |
| Molecular Formula | C17H16O4Se |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-phenylselanylethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCC[Se]c1ccccc1 |
| InChI | InChI=1S/C17H16O4Se/c18-15-8-6-13(12-16(15)19)7-9-17(20)21-10-11-22-14-4-2-1-3-5-14/h1-9,12,18-19H,10-11H2/b9-7+ |
| InChIKey | SDEDVQTYMKGVQX-VQHVLOKHSA-N |
| XLogP | 2.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|