C9H8O4 — CID 689043
(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid (PubChem CID 689043) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 689043 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+ |
| InChIKey | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| XLogP | 1.20 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|