C23H20O10 — CID 69114202
3,4-dihydroxybenzoic acid;4-hydroxybenzoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 69114202) has the molecular formula C23H20O10 and a molecular weight of 456.40 g/mol. Its IUPAC name is 3,4-dihydroxybenzoic acid;4-hydroxybenzoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | 3,4-dihydroxybenzoic acid;4-hydroxybenzoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 69114202 |
| Molecular Formula | C23H20O10 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3,4-dihydroxybenzoic acid;4-hydroxybenzoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(O)cc1.O=C(O)c1ccc(O)c(O)c1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3.C7H6O4.C7H6O3/c10-8-4-1-7(2-5-8)3-6-9(11)12;8-5-2-1-4(7(10)11)3-6(5)9;8-6-3-1-5(2-4-6)7(9)10/h1-6,10H,(H,11,12);1-3,8-9H,(H,10,11);1-4,8H,(H,9,10)/b6-3+;; |
| InChIKey | YAXRQLGCAYPTJL-RRHCXGJISA-N |
| XLogP | 3.38 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|