About ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid
ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 159734710) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| PubChem CID | 159734710 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | CCO.O=C(O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3.C2H6O/c10-8-4-1-7(2-5-8)3-6-9(11)12;1-2-3/h1-6,10H,(H,11,12);3H,2H2,1H3/b6-3+; |
| InChIKey | NBRMDZMLVJVNST-ZIKNSQGESA-N |
| XLogP | 1.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid?
The IUPAC name of ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid (CID 159734710) is ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid.
What is the SMILES notation for ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid?
The canonical SMILES for ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid is CCO.O=C(O)/C=C/c1ccc(O)cc1.
What is the InChIKey of ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid?
The InChIKey is NBRMDZMLVJVNST-ZIKNSQGESA-N. The full InChI is InChI=1S/C9H8O3.C2H6O/c10-8-4-1-7(2-5-8)3-6-9(11)12;1-2-3/h1-6,10H,(H,11,12);3H,2H2,1H3/b6-3+;.
What are the key properties of ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid?
ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid has a molecular weight of 210.23 g/mol, XLogP of 1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 159734710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).