C9H8O3 — CID 175665468
(E)-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)prop-2-enoic acid (PubChem CID 175665468) has the molecular formula C9H8O3 and a molecular weight of 173.09 g/mol. Its IUPAC name is (E)-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)prop-2-enoic acid.
| Compound Name | (E)-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)prop-2-enoic acid |
|---|---|
| PubChem CID | 175665468 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 173.09 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (E)-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)prop-2-enoic acid |
| SMILES | O=[13C](O)/[13CH]=[13CH]/[13c]1[13cH][13cH][13c](O)[13cH][13cH]1 |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | NGSWKAQJJWESNS-VHQBJQPISA-N |
| XLogP | 1.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|